About [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium
[2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium (PubChem CID 20734094) has the molecular formula C15H16Cl2N3O2S+
and a molecular weight of 373.29 g/mol. Its IUPAC name is [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium.
Molecular Properties
| Compound Name | [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium |
| PubChem CID | 20734094 |
| Molecular Formula | C15H16Cl2N3O2S+ |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium |
| SMILES | CN(C)c1ccc(N=[NH2+])c(S(=O)(=O)Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N3O2S/c1-20(2)12-5-6-14(19-18)15(8-12)23(21,22)9-10-3-4-11(16)7-13(10)17/h3-8,18H,9H2,1-2H3/p+1 |
| InChIKey | BXIVYZFICULNGB-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium?
The IUPAC name of [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium (CID 20734094) is [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium.
What is the SMILES notation for [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium?
The canonical SMILES for [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium is CN(C)c1ccc(N=[NH2+])c(S(=O)(=O)Cc2ccc(Cl)cc2Cl)c1.
What is the InChIKey of [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium?
The InChIKey is BXIVYZFICULNGB-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H15Cl2N3O2S/c1-20(2)12-5-6-14(19-18)15(8-12)23(21,22)9-10-3-4-11(16)7-13(10)17/h3-8,18H,9H2,1-2H3/p+1.
What are the key properties of [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium?
[2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium has a molecular weight of 373.29 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,4-dichlorophenyl)methylsulfonyl]-4-(dimethylamino)phenyl]iminoazanium is sourced from PubChem (CID 20734094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).