C43H50N6 — CID 20734211
N,N'-bis[(E)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylideneamino]-N,N'-diphenylpentane-1,5-diamine (PubChem CID 20734211) has the molecular formula C43H50N6 and a molecular weight of 650.92 g/mol. Its IUPAC name is N,N'-bis[(E)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylideneamino]-N,N'-diphenylpentane-1,5-diamine.
| Compound Name | N,N'-bis[(E)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylideneamino]-N,N'-diphenylpentane-1,5-diamine |
|---|---|
| PubChem CID | 20734211 |
| Molecular Formula | C43H50N6 |
| Molecular Weight | 650.92 g/mol |
| Exact Mass | 650.41 |
| IUPAC Name | N,N'-bis[(E)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylmethylideneamino]-N,N'-diphenylpentane-1,5-diamine |
| SMILES | C(=N/N(CCCCCN(/N=C/c1cc2c3c(c1)CCCN3CCC2)c1ccccc1)c1ccccc1)\c1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C43H50N6/c1-4-18-40(19-5-1)48(44-32-34-28-36-14-10-22-46-23-11-15-37(29-34)42(36)46)26-8-3-9-27-49(41-20-6-2-7-21-41)45-33-35-30-38-16-12-24-47-25-13-17-39(31-35)43(38)47/h1-2,4-7,18-21,28-33H,3,8-17,22-27H2/b44-32+,45-33+ |
| InChIKey | VNHAAOCKPKYRCN-UHLGSUOTSA-N |
| XLogP | 8.64 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.92 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|