C12H16F4O — CID 20734469
3-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4-tetrafluoropentan-3-ol (PubChem CID 20734469) has the molecular formula C12H16F4O and a molecular weight of 252.25 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4-tetrafluoropentan-3-ol.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4-tetrafluoropentan-3-ol |
|---|---|
| PubChem CID | 20734469 |
| Molecular Formula | C12H16F4O |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4-tetrafluoropentan-3-ol |
| SMILES | CC(F)(F)C(O)(C1CC2C=CC1C2)C(C)(F)F |
| InChI | InChI=1S/C12H16F4O/c1-10(13,14)12(17,11(2,15)16)9-6-7-3-4-8(9)5-7/h3-4,7-9,17H,5-6H2,1-2H3 |
| InChIKey | IFFYTJJEOSNFET-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|