C11H12F4O — CID 20734472
3,3,5,5-tetrafluoro-4-methyltricyclo[5.2.1.02,6]dec-8-en-4-ol (PubChem CID 20734472) has the molecular formula C11H12F4O and a molecular weight of 236.21 g/mol. Its IUPAC name is 3,3,5,5-tetrafluoro-4-methyltricyclo[5.2.1.02,6]dec-8-en-4-ol.
| Compound Name | 3,3,5,5-tetrafluoro-4-methyltricyclo[5.2.1.02,6]dec-8-en-4-ol |
|---|---|
| PubChem CID | 20734472 |
| Molecular Formula | C11H12F4O |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3,3,5,5-tetrafluoro-4-methyltricyclo[5.2.1.02,6]dec-8-en-4-ol |
| SMILES | CC1(O)C(F)(F)C2C3C=CC(C3)C2C1(F)F |
| InChI | InChI=1S/C11H12F4O/c1-9(16)10(12,13)7-5-2-3-6(4-5)8(7)11(9,14)15/h2-3,5-8,16H,4H2,1H3 |
| InChIKey | QUQMLDTYCFVZPN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|