C6H7F6O3S- — CID 20734548
3,3,4,4,5,5-hexafluorohexane-1-sulfonate (PubChem CID 20734548) has the molecular formula C6H7F6O3S- and a molecular weight of 273.17 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluorohexane-1-sulfonate.
| Compound Name | 3,3,4,4,5,5-hexafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 20734548 |
| Molecular Formula | C6H7F6O3S- |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 3,3,4,4,5,5-hexafluorohexane-1-sulfonate |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H8F6O3S/c1-4(7,8)6(11,12)5(9,10)2-3-16(13,14)15/h2-3H2,1H3,(H,13,14,15)/p-1 |
| InChIKey | RCJBIDJUXAYRCT-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|