C20H10F9NO6S — CID 20734551
(2,5-dioxo-3,4-diphenylpyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate (PubChem CID 20734551) has the molecular formula C20H10F9NO6S and a molecular weight of 563.35 g/mol. Its IUPAC name is (2,5-dioxo-3,4-diphenylpyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate.
| Compound Name | (2,5-dioxo-3,4-diphenylpyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 20734551 |
| Molecular Formula | C20H10F9NO6S |
| Molecular Weight | 563.35 g/mol |
| Exact Mass | 563.01 |
| IUPAC Name | (2,5-dioxo-3,4-diphenylpyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1OS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H10F9NO6S/c21-17(22,23)18(24,25)35-19(26,27)20(28,29)37(33,34)36-30-15(31)13(11-7-3-1-4-8-11)14(16(30)32)12-9-5-2-6-10-12/h1-10H |
| InChIKey | YJBCYBFYFCSUQR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|