C9H11NO — CID 20734599
3-methylidene-3a,4,7,7a-tetrahydroisoindol-1-one (PubChem CID 20734599) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-methylidene-3a,4,7,7a-tetrahydroisoindol-1-one.
| Compound Name | 3-methylidene-3a,4,7,7a-tetrahydroisoindol-1-one |
|---|---|
| PubChem CID | 20734599 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-methylidene-3a,4,7,7a-tetrahydroisoindol-1-one |
| SMILES | C=C1NC(=O)C2CC=CCC12 |
| InChI | InChI=1S/C9H11NO/c1-6-7-4-2-3-5-8(7)9(11)10-6/h2-3,7-8H,1,4-5H2,(H,10,11) |
| InChIKey | XWOIUAZBJHQZDN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|