C14H19NO4 — CID 20734636
2,2-dimethyl-5-[(E)-3-piperidin-1-ylprop-2-enylidene]-1,3-dioxane-4,6-dione (PubChem CID 20734636) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(E)-3-piperidin-1-ylprop-2-enylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(E)-3-piperidin-1-ylprop-2-enylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 20734636 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2,2-dimethyl-5-[(E)-3-piperidin-1-ylprop-2-enylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C/C=C/N2CCCCC2)C(=O)O1 |
| InChI | InChI=1S/C14H19NO4/c1-14(2)18-12(16)11(13(17)19-14)7-6-10-15-8-4-3-5-9-15/h6-7,10H,3-5,8-9H2,1-2H3/b10-6+ |
| InChIKey | UFJCXHSZLBCEFB-UXBLZVDNSA-N |
| XLogP | 1.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|