C29H35N5O5S — CID 20735232
1-cyclopropyl-N-hydroxy-4-[4-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 20735232) has the molecular formula C29H35N5O5S and a molecular weight of 565.70 g/mol. Its IUPAC name is 1-cyclopropyl-N-hydroxy-4-[4-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-N-hydroxy-4-[4-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20735232 |
| Molecular Formula | C29H35N5O5S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 1-cyclopropyl-N-hydroxy-4-[4-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(-c2noc(C3CCN(c4ccc(S(=O)(=O)C5(C(=O)NO)CCN(C6CC6)CC5)cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C29H35N5O5S/c1-20-2-4-21(5-3-20)26-30-27(39-32-26)22-12-16-33(17-13-22)24-8-10-25(11-9-24)40(37,38)29(28(35)31-36)14-18-34(19-15-29)23-6-7-23/h2-5,8-11,22-23,36H,6-7,12-19H2,1H3,(H,31,35) |
| InChIKey | IZOIMXXQNTUZAN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|