C15H20F3NO2 — CID 20735346
4-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methoxy]piperidine (PubChem CID 20735346) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methoxy]piperidine.
| Compound Name | 4-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methoxy]piperidine |
|---|---|
| PubChem CID | 20735346 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methoxy]piperidine |
| SMILES | FC(F)(F)COCc1ccc(COC2CCNCC2)cc1 |
| InChI | InChI=1S/C15H20F3NO2/c16-15(17,18)11-20-9-12-1-3-13(4-2-12)10-21-14-5-7-19-8-6-14/h1-4,14,19H,5-11H2 |
| InChIKey | FGHWOOKYTGSSEZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |