C17H20F7NO2 — CID 20735348
4-[[4-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)phenyl]methoxy]piperidine (PubChem CID 20735348) has the molecular formula C17H20F7NO2 and a molecular weight of 403.34 g/mol. Its IUPAC name is 4-[[4-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)phenyl]methoxy]piperidine.
| Compound Name | 4-[[4-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)phenyl]methoxy]piperidine |
|---|---|
| PubChem CID | 20735348 |
| Molecular Formula | C17H20F7NO2 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-[[4-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)phenyl]methoxy]piperidine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)COCc1ccc(COC2CCNCC2)cc1 |
| InChI | InChI=1S/C17H20F7NO2/c18-15(19,16(20,21)17(22,23)24)11-26-9-12-1-3-13(4-2-12)10-27-14-5-7-25-8-6-14/h1-4,14,25H,5-11H2 |
| InChIKey | YMPGAWAGQGEVDE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|