C20H23F10NO2 — CID 20735349
4-[[4-(2,2,3,3,4,4,5,5,6,6-decafluoroheptoxymethyl)phenyl]methoxy]piperidine (PubChem CID 20735349) has the molecular formula C20H23F10NO2 and a molecular weight of 499.39 g/mol. Its IUPAC name is 4-[[4-(2,2,3,3,4,4,5,5,6,6-decafluoroheptoxymethyl)phenyl]methoxy]piperidine.
| Compound Name | 4-[[4-(2,2,3,3,4,4,5,5,6,6-decafluoroheptoxymethyl)phenyl]methoxy]piperidine |
|---|---|
| PubChem CID | 20735349 |
| Molecular Formula | C20H23F10NO2 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 4-[[4-(2,2,3,3,4,4,5,5,6,6-decafluoroheptoxymethyl)phenyl]methoxy]piperidine |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCc1ccc(COC2CCNCC2)cc1 |
| InChI | InChI=1S/C20H23F10NO2/c1-16(21,22)18(25,26)20(29,30)19(27,28)17(23,24)12-32-10-13-2-4-14(5-3-13)11-33-15-6-8-31-9-7-15/h2-5,15,31H,6-12H2,1H3 |
| InChIKey | QCVLHDJOJKCTLB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|