C18H21F8NO2 — CID 20735350
4-[[4-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)phenyl]methoxy]piperidine (PubChem CID 20735350) has the molecular formula C18H21F8NO2 and a molecular weight of 435.36 g/mol. Its IUPAC name is 4-[[4-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)phenyl]methoxy]piperidine.
| Compound Name | 4-[[4-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)phenyl]methoxy]piperidine |
|---|---|
| PubChem CID | 20735350 |
| Molecular Formula | C18H21F8NO2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-[[4-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)phenyl]methoxy]piperidine |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)COCc1ccc(COC2CCNCC2)cc1 |
| InChI | InChI=1S/C18H21F8NO2/c19-15(20)17(23,24)18(25,26)16(21,22)11-28-9-12-1-3-13(4-2-12)10-29-14-5-7-27-8-6-14/h1-4,14-15,27H,5-11H2 |
| InChIKey | ZIXZCKYNDXDETJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|