C19H20F2N2O5S2 — CID 20735361
4-[4-[4-(difluoromethylsulfanyl)phenoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide (PubChem CID 20735361) has the molecular formula C19H20F2N2O5S2 and a molecular weight of 458.51 g/mol. Its IUPAC name is 4-[4-[4-(difluoromethylsulfanyl)phenoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide.
| Compound Name | 4-[4-[4-(difluoromethylsulfanyl)phenoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20735361 |
| Molecular Formula | C19H20F2N2O5S2 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 4-[4-[4-(difluoromethylsulfanyl)phenoxy]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(Oc3ccc(SC(F)F)cc3)cc2)CCNCC1 |
| InChI | InChI=1S/C19H20F2N2O5S2/c20-18(21)29-15-5-1-13(2-6-15)28-14-3-7-16(8-4-14)30(26,27)19(17(24)23-25)9-11-22-12-10-19/h1-8,18,22,25H,9-12H2,(H,23,24) |
| InChIKey | FFMQOQVCMAXIQZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|