C21H20N2O2S — CID 20735470
3-[2-(4-methylanilino)-2-oxoethyl]-N-(4-methylphenyl)thiophene-2-carboxamide (PubChem CID 20735470) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-[2-(4-methylanilino)-2-oxoethyl]-N-(4-methylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-[2-(4-methylanilino)-2-oxoethyl]-N-(4-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20735470 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-[2-(4-methylanilino)-2-oxoethyl]-N-(4-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccsc2C(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-14-3-7-17(8-4-14)22-19(24)13-16-11-12-26-20(16)21(25)23-18-9-5-15(2)6-10-18/h3-12H,13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | HIPYZJQMGQKAGW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |