ethyl 2-[methyl(2-methylpropyl)amino]acetate

C9H19NO2 — CID 20735594

IUPACethyl 2-[methyl(2-methylpropyl)amino]acetate
SMILESCCOC(=O)CN(C)CC(C)C
InChIInChI=1S/C9H19NO2/c1-5-12-9(11)7-10(4)6-8(2)3/h8H,5-7H2,1-4H3
InChIKeyWEKBBWRJGAZEIA-UHFFFAOYSA-N
MW173.26 g/mol
LogP1.14
Rot. Bonds5

About ethyl 2-[methyl(2-methylpropyl)amino]acetate

ethyl 2-[methyl(2-methylpropyl)amino]acetate (PubChem CID 20735594) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is ethyl 2-[methyl(2-methylpropyl)amino]acetate.

Molecular Properties

Compound Nameethyl 2-[methyl(2-methylpropyl)amino]acetate
PubChem CID20735594
Molecular FormulaC9H19NO2
Molecular Weight173.26 g/mol
Exact Mass173.14
IUPAC Nameethyl 2-[methyl(2-methylpropyl)amino]acetate
SMILESCCOC(=O)CN(C)CC(C)C
InChIInChI=1S/C9H19NO2/c1-5-12-9(11)7-10(4)6-8(2)3/h8H,5-7H2,1-4H3
InChIKeyWEKBBWRJGAZEIA-UHFFFAOYSA-N
XLogP1.14
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.26
LogP ≤ 51.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 2-[methyl(2-methylpropyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[methyl(2-methylpropyl)amino]acetate?
The IUPAC name of ethyl 2-[methyl(2-methylpropyl)amino]acetate (CID 20735594) is ethyl 2-[methyl(2-methylpropyl)amino]acetate.
What is the SMILES notation for ethyl 2-[methyl(2-methylpropyl)amino]acetate?
The canonical SMILES for ethyl 2-[methyl(2-methylpropyl)amino]acetate is CCOC(=O)CN(C)CC(C)C.
What is the InChIKey of ethyl 2-[methyl(2-methylpropyl)amino]acetate?
The InChIKey is WEKBBWRJGAZEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-5-12-9(11)7-10(4)6-8(2)3/h8H,5-7H2,1-4H3.
What are the key properties of ethyl 2-[methyl(2-methylpropyl)amino]acetate?
ethyl 2-[methyl(2-methylpropyl)amino]acetate has a molecular weight of 173.26 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[methyl(2-methylpropyl)amino]acetate is sourced from PubChem (CID 20735594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).