About pentane-1,2,4,5-tetramine
pentane-1,2,4,5-tetramine (PubChem CID 20735719) has the molecular formula C5H16N4
and a molecular weight of 132.21 g/mol. Its IUPAC name is pentane-1,2,4,5-tetramine.
Molecular Properties
| Compound Name | pentane-1,2,4,5-tetramine |
| PubChem CID | 20735719 |
| Molecular Formula | C5H16N4 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.14 |
| IUPAC Name | pentane-1,2,4,5-tetramine |
| SMILES | NCC(N)CC(N)CN |
| InChI | InChI=1S/C5H16N4/c6-2-4(8)1-5(9)3-7/h4-5H,1-3,6-9H2 |
| InChIKey | NDAXWIUFUFHGLG-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pentane-1,2,4,5-tetramine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-1,2,4,5-tetramine?
The IUPAC name of pentane-1,2,4,5-tetramine (CID 20735719) is pentane-1,2,4,5-tetramine.
What is the SMILES notation for pentane-1,2,4,5-tetramine?
The canonical SMILES for pentane-1,2,4,5-tetramine is NCC(N)CC(N)CN.
What is the InChIKey of pentane-1,2,4,5-tetramine?
The InChIKey is NDAXWIUFUFHGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H16N4/c6-2-4(8)1-5(9)3-7/h4-5H,1-3,6-9H2.
What are the key properties of pentane-1,2,4,5-tetramine?
pentane-1,2,4,5-tetramine has a molecular weight of 132.21 g/mol, XLogP of -2.05, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-1,2,4,5-tetramine is sourced from PubChem (CID 20735719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).