C66H57N7 — CID 20735925
2,3,5,6-tetramethyl-4-(1,10-phenanthrolin-5-yl)-N,N-bis[2,3,5,6-tetramethyl-4-(1,10-phenanthrolin-5-yl)phenyl]aniline (PubChem CID 20735925) has the molecular formula C66H57N7 and a molecular weight of 948.23 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-4-(1,10-phenanthrolin-5-yl)-N,N-bis[2,3,5,6-tetramethyl-4-(1,10-phenanthrolin-5-yl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetramethyl-4-(1,10-phenanthrolin-5-yl)-N,N-bis[2,3,5,6-tetramethyl-4-(1,10-phenanthrolin-5-yl)phenyl]aniline |
|---|---|
| PubChem CID | 20735925 |
| Molecular Formula | C66H57N7 |
| Molecular Weight | 948.23 g/mol |
| Exact Mass | 947.47 |
| IUPAC Name | 2,3,5,6-tetramethyl-4-(1,10-phenanthrolin-5-yl)-N,N-bis[2,3,5,6-tetramethyl-4-(1,10-phenanthrolin-5-yl)phenyl]aniline |
| SMILES | Cc1c(C)c(N(c2c(C)c(C)c(-c3cc4cccnc4c4ncccc34)c(C)c2C)c2c(C)c(C)c(-c3cc4cccnc4c4ncccc34)c(C)c2C)c(C)c(C)c1-c1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C66H57N7/c1-34-40(7)64(41(8)35(2)55(34)52-31-46-19-13-25-67-58(46)61-49(52)22-16-28-70-61)73(65-42(9)36(3)56(37(4)43(65)10)53-32-47-20-14-26-68-59(47)62-50(53)23-17-29-71-62)66-44(11)38(5)57(39(6)45(66)12)54-33-48-21-15-27-69-60(48)63-51(54)24-18-30-72-63/h13-33H,1-12H3 |
| InChIKey | NCZOHYXAYCHEQT-UHFFFAOYSA-N |
| XLogP | 17.15 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.23 |
| LogP ≤ 5 | 17.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|