C48H21F9N6 — CID 20735929
2-[3,5-bis[4-(2,4,6-trifluorophenyl)quinazolin-2-yl]phenyl]-4-(2,4,6-trifluorophenyl)quinazoline (PubChem CID 20735929) has the molecular formula C48H21F9N6 and a molecular weight of 852.72 g/mol. Its IUPAC name is 2-[3,5-bis[4-(2,4,6-trifluorophenyl)quinazolin-2-yl]phenyl]-4-(2,4,6-trifluorophenyl)quinazoline.
| Compound Name | 2-[3,5-bis[4-(2,4,6-trifluorophenyl)quinazolin-2-yl]phenyl]-4-(2,4,6-trifluorophenyl)quinazoline |
|---|---|
| PubChem CID | 20735929 |
| Molecular Formula | C48H21F9N6 |
| Molecular Weight | 852.72 g/mol |
| Exact Mass | 852.17 |
| IUPAC Name | 2-[3,5-bis[4-(2,4,6-trifluorophenyl)quinazolin-2-yl]phenyl]-4-(2,4,6-trifluorophenyl)quinazoline |
| SMILES | Fc1cc(F)c(-c2nc(-c3cc(-c4nc(-c5c(F)cc(F)cc5F)c5ccccc5n4)cc(-c4nc(-c5c(F)cc(F)cc5F)c5ccccc5n4)c3)nc3ccccc23)c(F)c1 |
| InChI | InChI=1S/C48H21F9N6/c49-25-16-31(52)40(32(53)17-25)43-28-7-1-4-10-37(28)58-46(61-43)22-13-23(47-59-38-11-5-2-8-29(38)44(62-47)41-33(54)18-26(50)19-34(41)55)15-24(14-22)48-60-39-12-6-3-9-30(39)45(63-48)42-35(56)20-27(51)21-36(42)57/h1-21H |
| InChIKey | UWNYIDQDANBKQC-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.72 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |