About (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate
(5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 20736082) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
Molecular Properties
| Compound Name | (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| PubChem CID | 20736082 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C1CCC(COC(=O)C2CC3C=CC2C3)O1 |
| InChI | InChI=1S/C13H16O4/c14-12-4-3-10(17-12)7-16-13(15)11-6-8-1-2-9(11)5-8/h1-2,8-11H,3-7H2 |
| InChIKey | AYSRWHOIRSQXMS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The IUPAC name of (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (CID 20736082) is (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
What is the SMILES notation for (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The canonical SMILES for (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is O=C1CCC(COC(=O)C2CC3C=CC2C3)O1.
What is the InChIKey of (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
The InChIKey is AYSRWHOIRSQXMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c14-12-4-3-10(17-12)7-16-13(15)11-6-8-1-2-9(11)5-8/h1-2,8-11H,3-7H2.
What are the key properties of (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate?
(5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate has a molecular weight of 236.27 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxooxolan-2-yl)methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate is sourced from PubChem (CID 20736082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).