About 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate
2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 20736093) has the molecular formula C20H26O4
and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
Molecular Properties
| Compound Name | 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| PubChem CID | 20736093 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | O=C1CCCC(CCOC(=O)C2CC3CC2C2C4C=CC(C4)C32)O1 |
| InChI | InChI=1S/C20H26O4/c21-17-3-1-2-14(24-17)6-7-23-20(22)16-10-13-9-15(16)19-12-5-4-11(8-12)18(13)19/h4-5,11-16,18-19H,1-3,6-10H2 |
| InChIKey | IRBSCCDPXSWGKC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The IUPAC name of 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (CID 20736093) is 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
What is the SMILES notation for 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The canonical SMILES for 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate is O=C1CCCC(CCOC(=O)C2CC3CC2C2C4C=CC(C4)C32)O1.
What is the InChIKey of 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The InChIKey is IRBSCCDPXSWGKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O4/c21-17-3-1-2-14(24-17)6-7-23-20(22)16-10-13-9-15(16)19-12-5-4-11(8-12)18(13)19/h4-5,11-16,18-19H,1-3,6-10H2.
What are the key properties of 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate has a molecular weight of 330.42 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-oxooxan-2-yl)ethyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate is sourced from PubChem (CID 20736093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).