C18H28O7 — CID 20736148
propan-2-yl 2-[4-(3-methoxy-2,2-dimethyl-3-oxopropyl)-2,5-dioxooxolan-3-yl]-2-methylbutanoate (PubChem CID 20736148) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is propan-2-yl 2-[4-(3-methoxy-2,2-dimethyl-3-oxopropyl)-2,5-dioxooxolan-3-yl]-2-methylbutanoate.
| Compound Name | propan-2-yl 2-[4-(3-methoxy-2,2-dimethyl-3-oxopropyl)-2,5-dioxooxolan-3-yl]-2-methylbutanoate |
|---|---|
| PubChem CID | 20736148 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | propan-2-yl 2-[4-(3-methoxy-2,2-dimethyl-3-oxopropyl)-2,5-dioxooxolan-3-yl]-2-methylbutanoate |
| SMILES | CCC(C)(C(=O)OC(C)C)C1C(=O)OC(=O)C1CC(C)(C)C(=O)OC |
| InChI | InChI=1S/C18H28O7/c1-8-18(6,16(22)24-10(2)3)12-11(13(19)25-14(12)20)9-17(4,5)15(21)23-7/h10-12H,8-9H2,1-7H3 |
| InChIKey | GCCQJAVUIMBOTN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|