C36H60O8 — CID 20736150
1-O-(2-hydroxyethyl) 5-O-[(3-methyl-2-bicyclo[2.2.1]heptanyl)methoxymethyl] 3-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20736150) has the molecular formula C36H60O8 and a molecular weight of 620.87 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-[(3-methyl-2-bicyclo[2.2.1]heptanyl)methoxymethyl] 3-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-[(3-methyl-2-bicyclo[2.2.1]heptanyl)methoxymethyl] 3-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20736150 |
| Molecular Formula | C36H60O8 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-[(3-methyl-2-bicyclo[2.2.1]heptanyl)methoxymethyl] 3-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCCO)C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)OCOCC1C2CCC(C2)C1C |
| InChI | InChI=1S/C36H60O8/c1-10-34(7,30(39)43-22-41-19-27-23(2)24-11-12-25(27)17-24)21-35(8,20-32(3,4)29(38)42-16-15-37)31(40)44-28-18-26-13-14-36(28,9)33(26,5)6/h23-28,37H,10-22H2,1-9H3 |
| InChIKey | JAERLTXMGNOVKW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|