C26H44O7 — CID 20736152
2-ethyl-7-(2-hydroxyethoxy)-2,4,6,6-tetramethyl-7-oxo-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]heptanoic acid (PubChem CID 20736152) has the molecular formula C26H44O7 and a molecular weight of 468.63 g/mol. Its IUPAC name is 2-ethyl-7-(2-hydroxyethoxy)-2,4,6,6-tetramethyl-7-oxo-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]heptanoic acid.
| Compound Name | 2-ethyl-7-(2-hydroxyethoxy)-2,4,6,6-tetramethyl-7-oxo-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]heptanoic acid |
|---|---|
| PubChem CID | 20736152 |
| Molecular Formula | C26H44O7 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 2-ethyl-7-(2-hydroxyethoxy)-2,4,6,6-tetramethyl-7-oxo-4-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]heptanoic acid |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OCCO)C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)O |
| InChI | InChI=1S/C26H44O7/c1-9-24(6,19(28)29)16-25(7,15-22(2,3)20(30)32-13-12-27)21(31)33-18-14-17-10-11-26(18,8)23(17,4)5/h17-18,27H,9-16H2,1-8H3,(H,28,29) |
| InChIKey | LWASRZCNQSQTJT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |