C40H52F6O5 — CID 20736160
4-[4-[4-(1-ethoxyethoxy)phenyl]-6-[4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]phenyl]-2,4,6-trimethyloctan-2-yl]phenol (PubChem CID 20736160) has the molecular formula C40H52F6O5 and a molecular weight of 726.84 g/mol. Its IUPAC name is 4-[4-[4-(1-ethoxyethoxy)phenyl]-6-[4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]phenyl]-2,4,6-trimethyloctan-2-yl]phenol.
| Compound Name | 4-[4-[4-(1-ethoxyethoxy)phenyl]-6-[4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]phenyl]-2,4,6-trimethyloctan-2-yl]phenol |
|---|---|
| PubChem CID | 20736160 |
| Molecular Formula | C40H52F6O5 |
| Molecular Weight | 726.84 g/mol |
| Exact Mass | 726.37 |
| IUPAC Name | 4-[4-[4-(1-ethoxyethoxy)phenyl]-6-[4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]phenyl]-2,4,6-trimethyloctan-2-yl]phenol |
| SMILES | CCOCOC(Cc1ccc(C(C)(CC)CC(C)(CC(C)(C)c2ccc(O)cc2)c2ccc(OC(C)OCC)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C40H52F6O5/c1-9-36(7,31-14-12-29(13-15-31)24-38(39(41,42)43,40(44,45)46)50-27-48-10-2)26-37(8,25-35(5,6)30-16-20-33(47)21-17-30)32-18-22-34(23-19-32)51-28(4)49-11-3/h12-23,28,47H,9-11,24-27H2,1-8H3 |
| InChIKey | QWDGHGPBFDDNFC-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.84 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|