C13H26N4O2 — CID 20736228
N-[2-[2-(4-methylpiperidin-1-yl)ethylcarbamoylamino]ethyl]acetamide (PubChem CID 20736228) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[2-[2-(4-methylpiperidin-1-yl)ethylcarbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[2-(4-methylpiperidin-1-yl)ethylcarbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 20736228 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[2-[2-(4-methylpiperidin-1-yl)ethylcarbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)NCCN1CCC(C)CC1 |
| InChI | InChI=1S/C13H26N4O2/c1-11-3-8-17(9-4-11)10-7-16-13(19)15-6-5-14-12(2)18/h11H,3-10H2,1-2H3,(H,14,18)(H2,15,16,19) |
| InChIKey | PFPIGBYXAMIAEJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|