About copper;4-methylpent-1-enoxycyclohexane;cyanide
copper;4-methylpent-1-enoxycyclohexane;cyanide (PubChem CID 20736458) has the molecular formula C13H21CuNO
and a molecular weight of 270.86 g/mol. Its IUPAC name is copper;4-methylpent-1-enoxycyclohexane;cyanide.
Molecular Properties
| Compound Name | copper;4-methylpent-1-enoxycyclohexane;cyanide |
| PubChem CID | 20736458 |
| Molecular Formula | C13H21CuNO |
| Molecular Weight | 270.86 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | copper;4-methylpent-1-enoxycyclohexane;cyanide |
| SMILES | CC(C)C/C=[C-]/OC1CCCCC1.[C-]#N.[Cu+2] |
| InChI | InChI=1S/C12H21O.CN.Cu/c1-11(2)7-6-10-13-12-8-4-3-5-9-12;1-2;/h6,11-12H,3-5,7-9H2,1-2H3;;/q2*-1;+2 |
| InChIKey | IOFCXFDXPWQLLH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper;4-methylpent-1-enoxycyclohexane;cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;4-methylpent-1-enoxycyclohexane;cyanide?
The IUPAC name of copper;4-methylpent-1-enoxycyclohexane;cyanide (CID 20736458) is copper;4-methylpent-1-enoxycyclohexane;cyanide.
What is the SMILES notation for copper;4-methylpent-1-enoxycyclohexane;cyanide?
The canonical SMILES for copper;4-methylpent-1-enoxycyclohexane;cyanide is CC(C)C/C=[C-]/OC1CCCCC1.[C-]#N.[Cu+2].
What is the InChIKey of copper;4-methylpent-1-enoxycyclohexane;cyanide?
The InChIKey is IOFCXFDXPWQLLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21O.CN.Cu/c1-11(2)7-6-10-13-12-8-4-3-5-9-12;1-2;/h6,11-12H,3-5,7-9H2,1-2H3;;/q2*-1;+2.
What are the key properties of copper;4-methylpent-1-enoxycyclohexane;cyanide?
copper;4-methylpent-1-enoxycyclohexane;cyanide has a molecular weight of 270.86 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;4-methylpent-1-enoxycyclohexane;cyanide is sourced from PubChem (CID 20736458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).