C36H45FN2O11 — CID 20736483
6-[[2-(9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]carbonylamino]hexyl (4-nitrophenyl) carbonate (PubChem CID 20736483) has the molecular formula C36H45FN2O11 and a molecular weight of 700.76 g/mol. Its IUPAC name is 6-[[2-(9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]carbonylamino]hexyl (4-nitrophenyl) carbonate.
| Compound Name | 6-[[2-(9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]carbonylamino]hexyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 20736483 |
| Molecular Formula | C36H45FN2O11 |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | 6-[[2-(9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]carbonylamino]hexyl (4-nitrophenyl) carbonate |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC2(C)C1(O)C(=O)COC(=O)NCCCCCCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H45FN2O11/c1-22-18-28-27-13-8-23-19-25(40)14-15-33(23,2)35(27,37)29(41)20-34(28,3)36(22,45)30(42)21-49-31(43)38-16-6-4-5-7-17-48-32(44)50-26-11-9-24(10-12-26)39(46)47/h9-12,14-15,19,22,27-29,41,45H,4-8,13,16-18,20-21H2,1-3H3,(H,38,43) |
| InChIKey | FXEBKFBPGFTQKC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|