C25H23ClO5S2 — CID 20737427
6-[2-(4-chlorophenyl)sulfanyl-6-oxocyclohexene-1-carbonyl]-3,3,5-trimethyl-1,1-dioxo-2H-thiochromen-4-one (PubChem CID 20737427) has the molecular formula C25H23ClO5S2 and a molecular weight of 503.04 g/mol. Its IUPAC name is 6-[2-(4-chlorophenyl)sulfanyl-6-oxocyclohexene-1-carbonyl]-3,3,5-trimethyl-1,1-dioxo-2H-thiochromen-4-one.
| Compound Name | 6-[2-(4-chlorophenyl)sulfanyl-6-oxocyclohexene-1-carbonyl]-3,3,5-trimethyl-1,1-dioxo-2H-thiochromen-4-one |
|---|---|
| PubChem CID | 20737427 |
| Molecular Formula | C25H23ClO5S2 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 6-[2-(4-chlorophenyl)sulfanyl-6-oxocyclohexene-1-carbonyl]-3,3,5-trimethyl-1,1-dioxo-2H-thiochromen-4-one |
| SMILES | Cc1c(C(=O)C2=C(Sc3ccc(Cl)cc3)CCCC2=O)ccc2c1C(=O)C(C)(C)CS2(=O)=O |
| InChI | InChI=1S/C25H23ClO5S2/c1-14-17(11-12-20-21(14)24(29)25(2,3)13-33(20,30)31)23(28)22-18(27)5-4-6-19(22)32-16-9-7-15(26)8-10-16/h7-12H,4-6,13H2,1-3H3 |
| InChIKey | FLSJVLVOJLHGJG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|