C26H34N5O2S+ — CID 20737719
[4-amino-2-[4-[4-(3-hydroxypropyl)-4-methylpiperazin-4-ium-1-yl]anilino]-1,3-thiazol-5-yl]-(3-ethylphenyl)methanone (PubChem CID 20737719) has the molecular formula C26H34N5O2S+ and a molecular weight of 480.66 g/mol. Its IUPAC name is [4-amino-2-[4-[4-(3-hydroxypropyl)-4-methylpiperazin-4-ium-1-yl]anilino]-1,3-thiazol-5-yl]-(3-ethylphenyl)methanone.
| Compound Name | [4-amino-2-[4-[4-(3-hydroxypropyl)-4-methylpiperazin-4-ium-1-yl]anilino]-1,3-thiazol-5-yl]-(3-ethylphenyl)methanone |
|---|---|
| PubChem CID | 20737719 |
| Molecular Formula | C26H34N5O2S+ |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [4-amino-2-[4-[4-(3-hydroxypropyl)-4-methylpiperazin-4-ium-1-yl]anilino]-1,3-thiazol-5-yl]-(3-ethylphenyl)methanone |
| SMILES | CCc1cccc(C(=O)c2sc(Nc3ccc(N4CC[N+](C)(CCCO)CC4)cc3)nc2N)c1 |
| InChI | InChI=1S/C26H33N5O2S/c1-3-19-6-4-7-20(18-19)23(33)24-25(27)29-26(34-24)28-21-8-10-22(11-9-21)30-12-15-31(2,16-13-30)14-5-17-32/h4,6-11,18,32H,3,5,12-17H2,1-2H3,(H2-,27,28,29,33)/p+1 |
| InChIKey | DUUYYVPMSCFLBV-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|