C29H26BrClO3 — CID 20737749
7-[3-(3-bromopropoxy)phenyl]-12-chloro-3,9-dimethoxy-5,6-dihydrobenzo[a]anthracene (PubChem CID 20737749) has the molecular formula C29H26BrClO3 and a molecular weight of 537.88 g/mol. Its IUPAC name is 7-[3-(3-bromopropoxy)phenyl]-12-chloro-3,9-dimethoxy-5,6-dihydrobenzo[a]anthracene.
| Compound Name | 7-[3-(3-bromopropoxy)phenyl]-12-chloro-3,9-dimethoxy-5,6-dihydrobenzo[a]anthracene |
|---|---|
| PubChem CID | 20737749 |
| Molecular Formula | C29H26BrClO3 |
| Molecular Weight | 537.88 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 7-[3-(3-bromopropoxy)phenyl]-12-chloro-3,9-dimethoxy-5,6-dihydrobenzo[a]anthracene |
| SMILES | COc1ccc2c(c1)CCc1c-2c(Cl)c2ccc(OC)cc2c1-c1cccc(OCCCBr)c1 |
| InChI | InChI=1S/C29H26BrClO3/c1-32-20-8-11-23-18(15-20)7-10-25-27(19-5-3-6-22(16-19)34-14-4-13-30)26-17-21(33-2)9-12-24(26)29(31)28(23)25/h3,5-6,8-9,11-12,15-17H,4,7,10,13-14H2,1-2H3 |
| InChIKey | SGVRWXZDQXXAAH-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.88 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|