C18H23NO6 — CID 20738223
4-[[1-(3-methylbutanoyl)pyrrolidin-2-yl]methoxy]phthalic acid (PubChem CID 20738223) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 4-[[1-(3-methylbutanoyl)pyrrolidin-2-yl]methoxy]phthalic acid.
| Compound Name | 4-[[1-(3-methylbutanoyl)pyrrolidin-2-yl]methoxy]phthalic acid |
|---|---|
| PubChem CID | 20738223 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-[[1-(3-methylbutanoyl)pyrrolidin-2-yl]methoxy]phthalic acid |
| SMILES | CC(C)CC(=O)N1CCCC1COc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H23NO6/c1-11(2)8-16(20)19-7-3-4-12(19)10-25-13-5-6-14(17(21)22)15(9-13)18(23)24/h5-6,9,11-12H,3-4,7-8,10H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | HDXDWGQHSDAELA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |