About ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate
ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate (PubChem CID 20738505) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate |
| PubChem CID | 20738505 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CO)ncc1-c1cccc(C)c1C |
| InChI | InChI=1S/C16H18N2O3/c1-4-21-16(20)15-13(8-17-14(9-19)18-15)12-7-5-6-10(2)11(12)3/h5-8,19H,4,9H2,1-3H3 |
| InChIKey | YAYDPWNSPVAXDA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate?
The IUPAC name of ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate (CID 20738505) is ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate.
What is the SMILES notation for ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate?
The canonical SMILES for ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate is CCOC(=O)c1nc(CO)ncc1-c1cccc(C)c1C.
What is the InChIKey of ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate?
The InChIKey is YAYDPWNSPVAXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-4-21-16(20)15-13(8-17-14(9-19)18-15)12-7-5-6-10(2)11(12)3/h5-8,19H,4,9H2,1-3H3.
What are the key properties of ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate?
ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate has a molecular weight of 286.33 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2,3-dimethylphenyl)-2-(hydroxymethyl)pyrimidine-4-carboxylate is sourced from PubChem (CID 20738505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).