C29H40O6SSi — CID 20739022
[(2S,3R,4S,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethylsulfanyl-5-hydroxy-4-prop-2-enoxyoxan-3-yl] acetate (PubChem CID 20739022) has the molecular formula C29H40O6SSi and a molecular weight of 544.79 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethylsulfanyl-5-hydroxy-4-prop-2-enoxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethylsulfanyl-5-hydroxy-4-prop-2-enoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 20739022 |
| Molecular Formula | C29H40O6SSi |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethylsulfanyl-5-hydroxy-4-prop-2-enoxyoxan-3-yl] acetate |
| SMILES | C=CCO[C@H]1[C@@H](O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](SCC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H40O6SSi/c1-7-19-32-26-25(31)24(35-28(36-8-2)27(26)34-21(3)30)20-33-37(29(4,5)6,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h7,9-18,24-28,31H,1,8,19-20H2,2-6H3/t24-,25+,26+,27-,28+/m1/s1 |
| InChIKey | IZNAEJSKOQLFEX-JYIVOWJTSA-N |
| XLogP | 3.90 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|