C28H40O6Si — CID 20739044
[(3aS,4R,7R,7aS)-7-ethoxy-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 20739044) has the molecular formula C28H40O6Si and a molecular weight of 500.71 g/mol. Its IUPAC name is [(3aS,4R,7R,7aS)-7-ethoxy-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,4R,7R,7aS)-7-ethoxy-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 20739044 |
| Molecular Formula | C28H40O6Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | [(3aS,4R,7R,7aS)-7-ethoxy-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CCO[C@H]1C(OC)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C28H40O6Si/c1-8-30-25-24-23(33-28(5,6)34-24)22(32-26(25)29-7)19-31-35(27(2,3)4,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18,22-26H,8,19H2,1-7H3/t22-,23+,24+,25-,26?/m1/s1 |
| InChIKey | UVHLUDUKRNUPNE-PPILAZRBSA-N |
| XLogP | 3.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|