C29H42O6Si — CID 20739056
[(3aS,4R,7R,7aS)-6-methoxy-2,2-dimethyl-7-propoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 20739056) has the molecular formula C29H42O6Si and a molecular weight of 514.74 g/mol. Its IUPAC name is [(3aS,4R,7R,7aS)-6-methoxy-2,2-dimethyl-7-propoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,4R,7R,7aS)-6-methoxy-2,2-dimethyl-7-propoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 20739056 |
| Molecular Formula | C29H42O6Si |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [(3aS,4R,7R,7aS)-6-methoxy-2,2-dimethyl-7-propoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CCCO[C@H]1C(OC)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C29H42O6Si/c1-8-19-31-26-25-24(34-29(5,6)35-25)23(33-27(26)30-7)20-32-36(28(2,3)4,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,23-27H,8,19-20H2,1-7H3/t23-,24+,25+,26-,27?/m1/s1 |
| InChIKey | OQKOAVVYBJYSMO-TYQVVOABSA-N |
| XLogP | 4.25 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|