C27H38O6Si — CID 20739059
[(3aS,4R,7R,7aS)-6,7-dimethoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 20739059) has the molecular formula C27H38O6Si and a molecular weight of 486.68 g/mol. Its IUPAC name is [(3aS,4R,7R,7aS)-6,7-dimethoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,4R,7R,7aS)-6,7-dimethoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 20739059 |
| Molecular Formula | C27H38O6Si |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | [(3aS,4R,7R,7aS)-6,7-dimethoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | COC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C27H38O6Si/c1-26(2,3)34(19-14-10-8-11-15-19,20-16-12-9-13-17-20)30-18-21-22-23(33-27(4,5)32-22)24(28-6)25(29-7)31-21/h8-17,21-25H,18H2,1-7H3/t21-,22+,23+,24-,25?/m1/s1 |
| InChIKey | LNOZYVHOYMMAMV-VJIQZMARSA-N |
| XLogP | 3.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|