About cyclopropanesulfinate
cyclopropanesulfinate (PubChem CID 20739353) has the molecular formula C3H5O2S-
and a molecular weight of 105.14 g/mol. Its IUPAC name is cyclopropanesulfinate.
Molecular Properties
| Compound Name | cyclopropanesulfinate |
| PubChem CID | 20739353 |
| Molecular Formula | C3H5O2S- |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.00 |
| IUPAC Name | cyclopropanesulfinate |
| SMILES | O=S([O-])C1CC1 |
| InChI | InChI=1S/C3H6O2S/c4-6(5)3-1-2-3/h3H,1-2H2,(H,4,5)/p-1 |
| InChIKey | SJNAEBWOVPMUKS-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanesulfinate?
The IUPAC name of cyclopropanesulfinate (CID 20739353) is cyclopropanesulfinate.
What is the SMILES notation for cyclopropanesulfinate?
The canonical SMILES for cyclopropanesulfinate is O=S([O-])C1CC1.
What is the InChIKey of cyclopropanesulfinate?
The InChIKey is SJNAEBWOVPMUKS-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2S/c4-6(5)3-1-2-3/h3H,1-2H2,(H,4,5)/p-1.
What are the key properties of cyclopropanesulfinate?
cyclopropanesulfinate has a molecular weight of 105.14 g/mol, XLogP of 0.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanesulfinate is sourced from PubChem (CID 20739353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).