C28H25FN2O6S2 — CID 20739437
3-[2-[(E)-2-[(Z)-[3-(carboxymethyl)-5-fluoro-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 20739437) has the molecular formula C28H25FN2O6S2 and a molecular weight of 568.65 g/mol. Its IUPAC name is 3-[2-[(E)-2-[(Z)-[3-(carboxymethyl)-5-fluoro-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E)-2-[(Z)-[3-(carboxymethyl)-5-fluoro-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20739437 |
| Molecular Formula | C28H25FN2O6S2 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 3-[2-[(E)-2-[(Z)-[3-(carboxymethyl)-5-fluoro-1,3-benzothiazol-2-ylidene]methyl]but-1-enyl]benzo[e][1,3]benzoxazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCC(/C=C1\Sc2ccc(F)cc2N1CC(=O)O)=C\c1oc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C28H25FN2O6S2/c1-2-18(15-26-31(17-27(32)33)22-16-20(29)9-11-24(22)38-26)14-25-30(12-5-13-39(34,35)36)28-21-7-4-3-6-19(21)8-10-23(28)37-25/h3-4,6-11,14-16H,2,5,12-13,17H2,1H3,(H-,32,33,34,35,36) |
| InChIKey | BBSQFFQSBAISSZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|