C31H54O2 — CID 20739500
17-(2-hydroxy-6-methylhept-5-en-2-yl)-3,4,4,8,10,14-hexamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-ol (PubChem CID 20739500) has the molecular formula C31H54O2 and a molecular weight of 458.77 g/mol. Its IUPAC name is 17-(2-hydroxy-6-methylhept-5-en-2-yl)-3,4,4,8,10,14-hexamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-ol.
| Compound Name | 17-(2-hydroxy-6-methylhept-5-en-2-yl)-3,4,4,8,10,14-hexamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-ol |
|---|---|
| PubChem CID | 20739500 |
| Molecular Formula | C31H54O2 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.41 |
| IUPAC Name | 17-(2-hydroxy-6-methylhept-5-en-2-yl)-3,4,4,8,10,14-hexamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-12-ol |
| SMILES | CC(C)=CCCC(C)(O)C1CCC2(C)C1C(O)CC1C3(C)CCC(C)C(C)(C)C3CCC12C |
| InChI | InChI=1S/C31H54O2/c1-20(2)11-10-15-31(9,33)22-13-17-30(8)26(22)23(32)19-25-28(6)16-12-21(3)27(4,5)24(28)14-18-29(25,30)7/h11,21-26,32-33H,10,12-19H2,1-9H3 |
| InChIKey | DEAIUGUSCASRSU-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|