C28H34N4O3 — CID 20739721
1-N-(3-methylbutyl)-1-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)cyclopentane-1,1-dicarboxamide (PubChem CID 20739721) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 1-N-(3-methylbutyl)-1-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N-(3-methylbutyl)-1-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 20739721 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 1-N-(3-methylbutyl)-1-N'-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)cyclopentane-1,1-dicarboxamide |
| SMILES | CC(C)CCNC(=O)C1(C(=O)NC2N=C(c3ccccc3)c3ccccc3N(C)C2=O)CCCC1 |
| InChI | InChI=1S/C28H34N4O3/c1-19(2)15-18-29-26(34)28(16-9-10-17-28)27(35)31-24-25(33)32(3)22-14-8-7-13-21(22)23(30-24)20-11-5-4-6-12-20/h4-8,11-14,19,24H,9-10,15-18H2,1-3H3,(H,29,34)(H,31,35) |
| InChIKey | MBLFHSVTVWFNBT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|