C28H17Cl2NO6 — CID 20739763
5-(4-acetylphenyl)-1-(3,4-dichlorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 20739763) has the molecular formula C28H17Cl2NO6 and a molecular weight of 534.35 g/mol. Its IUPAC name is 5-(4-acetylphenyl)-1-(3,4-dichlorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | 5-(4-acetylphenyl)-1-(3,4-dichlorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 20739763 |
| Molecular Formula | C28H17Cl2NO6 |
| Molecular Weight | 534.35 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | 5-(4-acetylphenyl)-1-(3,4-dichlorophenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | CC(=O)c1ccc(N2C(=O)C3C(c4ccc(Cl)c(Cl)c4)OC4(C(=O)c5ccccc5C4=O)C3C2=O)cc1 |
| InChI | InChI=1S/C28H17Cl2NO6/c1-13(32)14-6-9-16(10-7-14)31-26(35)21-22(27(31)36)28(24(33)17-4-2-3-5-18(17)25(28)34)37-23(21)15-8-11-19(29)20(30)12-15/h2-12,21-23H,1H3 |
| InChIKey | KZEVHWZVNBRNDL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|