C30H30FN4O2+ — CID 20740086
(4-fluorophenyl)-oxo-[4-[6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-1H-benzimidazol-2-yl]phenyl]azanium (PubChem CID 20740086) has the molecular formula C30H30FN4O2+ and a molecular weight of 497.59 g/mol. Its IUPAC name is (4-fluorophenyl)-oxo-[4-[6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-1H-benzimidazol-2-yl]phenyl]azanium.
| Compound Name | (4-fluorophenyl)-oxo-[4-[6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-1H-benzimidazol-2-yl]phenyl]azanium |
|---|---|
| PubChem CID | 20740086 |
| Molecular Formula | C30H30FN4O2+ |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (4-fluorophenyl)-oxo-[4-[6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]-1H-benzimidazol-2-yl]phenyl]azanium |
| SMILES | CC1(C)C2CCC1(C)C(NC(=O)c1ccc3nc(-c4ccc([N+](=O)c5ccc(F)cc5)cc4)[nH]c3c1)C2 |
| InChI | InChI=1S/C30H29FN4O2/c1-29(2)20-14-15-30(29,3)26(17-20)34-28(36)19-6-13-24-25(16-19)33-27(32-24)18-4-9-22(10-5-18)35(37)23-11-7-21(31)8-12-23/h4-13,16,20,26H,14-15,17H2,1-3H3,(H-,32,33,34,36,37)/p+1 |
| InChIKey | PZITVEWGLQAETB-UHFFFAOYSA-O |
| XLogP | 6.91 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|