C28H20F5N3O2 — CID 20740133
N-(2-bicyclo[2.2.1]heptanyl)-2-[4-(2,3,4,5,6-pentafluorobenzoyl)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 20740133) has the molecular formula C28H20F5N3O2 and a molecular weight of 525.48 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-2-[4-(2,3,4,5,6-pentafluorobenzoyl)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-2-[4-(2,3,4,5,6-pentafluorobenzoyl)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 20740133 |
| Molecular Formula | C28H20F5N3O2 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-2-[4-(2,3,4,5,6-pentafluorobenzoyl)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NC1CC2CCC1C2)c1ccc2nc(-c3ccc(C(=O)c4c(F)c(F)c(F)c(F)c4F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C28H20F5N3O2/c29-21-20(22(30)24(32)25(33)23(21)31)26(37)13-3-5-14(6-4-13)27-34-17-8-7-16(11-19(17)35-27)28(38)36-18-10-12-1-2-15(18)9-12/h3-8,11-12,15,18H,1-2,9-10H2,(H,34,35)(H,36,38) |
| InChIKey | OQULPCNHCLAZIL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|