C24H20N2O4 — CID 20740450
2-[5-methyl-2-[1-(quinolin-3-ylmethyl)pyrrole-2-carbonyl]phenoxy]acetic acid (PubChem CID 20740450) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[5-methyl-2-[1-(quinolin-3-ylmethyl)pyrrole-2-carbonyl]phenoxy]acetic acid.
| Compound Name | 2-[5-methyl-2-[1-(quinolin-3-ylmethyl)pyrrole-2-carbonyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 20740450 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[5-methyl-2-[1-(quinolin-3-ylmethyl)pyrrole-2-carbonyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(C(=O)c2cccn2Cc2cnc3ccccc3c2)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C24H20N2O4/c1-16-8-9-19(22(11-16)30-15-23(27)28)24(29)21-7-4-10-26(21)14-17-12-18-5-2-3-6-20(18)25-13-17/h2-13H,14-15H2,1H3,(H,27,28) |
| InChIKey | CBFUSLRQFYNJRX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |