C9H17N2O4- — CID 20740532
(2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate (PubChem CID 20740532) has the molecular formula C9H17N2O4- and a molecular weight of 217.24 g/mol. Its IUPAC name is (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate.
| Compound Name | (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate |
|---|---|
| PubChem CID | 20740532 |
| Molecular Formula | C9H17N2O4- |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate |
| SMILES | CC1C(O[N+](=O)[O-])C(C)(C)N([O-])C1(C)C |
| InChI | InChI=1S/C9H17N2O4/c1-6-7(15-11(13)14)9(4,5)10(12)8(6,2)3/h6-7H,1-5H3/q-1 |
| InChIKey | VQBPJDVZXQYTNA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|