(2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate

C9H17N2O4- — CID 20740532

IUPAC(2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate
SMILESCC1C(O[N+](=O)[O-])C(C)(C)N([O-])C1(C)C
InChIInChI=1S/C9H17N2O4/c1-6-7(15-11(13)14)9(4,5)10(12)8(6,2)3/h6-7H,1-5H3/q-1
InChIKeyVQBPJDVZXQYTNA-UHFFFAOYSA-N
MW217.24 g/mol
LogP1.57
Rot. Bonds2

About (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate

(2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate (PubChem CID 20740532) has the molecular formula C9H17N2O4- and a molecular weight of 217.24 g/mol. Its IUPAC name is (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate.

Molecular Properties

Compound Name(2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate
PubChem CID20740532
Molecular FormulaC9H17N2O4-
Molecular Weight217.24 g/mol
Exact Mass217.12
IUPAC Name(2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate
SMILESCC1C(O[N+](=O)[O-])C(C)(C)N([O-])C1(C)C
InChIInChI=1S/C9H17N2O4/c1-6-7(15-11(13)14)9(4,5)10(12)8(6,2)3/h6-7H,1-5H3/q-1
InChIKeyVQBPJDVZXQYTNA-UHFFFAOYSA-N
XLogP1.57
TPSA78.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.24
LogP ≤ 51.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate?
The IUPAC name of (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate (CID 20740532) is (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate.
What is the SMILES notation for (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate?
The canonical SMILES for (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate is CC1C(O[N+](=O)[O-])C(C)(C)N([O-])C1(C)C.
What is the InChIKey of (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate?
The InChIKey is VQBPJDVZXQYTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N2O4/c1-6-7(15-11(13)14)9(4,5)10(12)8(6,2)3/h6-7H,1-5H3/q-1.
What are the key properties of (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate?
(2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate has a molecular weight of 217.24 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,4,5,5-pentamethyl-1-oxidopyrrolidin-3-yl) nitrate is sourced from PubChem (CID 20740532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).