C9H17N3O7 — CID 20740536
[1-hydroxy-2,2,5,5-tetramethyl-4-(nitrooxymethyl)pyrrolidin-3-yl] nitrate (PubChem CID 20740536) has the molecular formula C9H17N3O7 and a molecular weight of 279.25 g/mol. Its IUPAC name is [1-hydroxy-2,2,5,5-tetramethyl-4-(nitrooxymethyl)pyrrolidin-3-yl] nitrate.
| Compound Name | [1-hydroxy-2,2,5,5-tetramethyl-4-(nitrooxymethyl)pyrrolidin-3-yl] nitrate |
|---|---|
| PubChem CID | 20740536 |
| Molecular Formula | C9H17N3O7 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | [1-hydroxy-2,2,5,5-tetramethyl-4-(nitrooxymethyl)pyrrolidin-3-yl] nitrate |
| SMILES | CC1(C)C(CO[N+](=O)[O-])C(O[N+](=O)[O-])C(C)(C)N1O |
| InChI | InChI=1S/C9H17N3O7/c1-8(2)6(5-18-11(14)15)7(19-12(16)17)9(3,4)10(8)13/h6-7,13H,5H2,1-4H3 |
| InChIKey | LWOMETLOFFSGKT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|