C14H17F3NO2S+ — CID 20740652
1-[2-[4-(trifluoromethyl)phenyl]sulfonylethyl]-3,4,5,6-tetrahydro-2H-pyridin-4-ylium (PubChem CID 20740652) has the molecular formula C14H17F3NO2S+ and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-[2-[4-(trifluoromethyl)phenyl]sulfonylethyl]-3,4,5,6-tetrahydro-2H-pyridin-4-ylium.
| Compound Name | 1-[2-[4-(trifluoromethyl)phenyl]sulfonylethyl]-3,4,5,6-tetrahydro-2H-pyridin-4-ylium |
|---|---|
| PubChem CID | 20740652 |
| Molecular Formula | C14H17F3NO2S+ |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-[2-[4-(trifluoromethyl)phenyl]sulfonylethyl]-3,4,5,6-tetrahydro-2H-pyridin-4-ylium |
| SMILES | O=S(=O)(CCN1CC[CH+]CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3NO2S/c15-14(16,17)12-4-6-13(7-5-12)21(19,20)11-10-18-8-2-1-3-9-18/h1,4-7H,2-3,8-11H2/q+1 |
| InChIKey | IQAZYMYMJNVOPE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|