C28H22N3O2Y+2 — CID 20740673
(2E)-8-benzyl-2-[(2,4-dimethylbenzene-3-id-1-yl)methylidene]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-one;yttrium(3+) (PubChem CID 20740673) has the molecular formula C28H22N3O2Y+2 and a molecular weight of 521.41 g/mol. Its IUPAC name is (2E)-8-benzyl-2-[(2,4-dimethylbenzene-3-id-1-yl)methylidene]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-one;yttrium(3+).
| Compound Name | (2E)-8-benzyl-2-[(2,4-dimethylbenzene-3-id-1-yl)methylidene]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-one;yttrium(3+) |
|---|---|
| PubChem CID | 20740673 |
| Molecular Formula | C28H22N3O2Y+2 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | (2E)-8-benzyl-2-[(2,4-dimethylbenzene-3-id-1-yl)methylidene]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-one;yttrium(3+) |
| SMILES | Cc1[c-]c(C)c(/C=C2/N=C3C(Cc4ccccc4)=NC(c4ccc(O)cc4)=CN3C2=O)cc1.[Y+3] |
| InChI | InChI=1S/C28H22N3O2.Y/c1-18-8-9-22(19(2)14-18)16-25-28(33)31-17-26(21-10-12-23(32)13-11-21)29-24(27(31)30-25)15-20-6-4-3-5-7-20;/h3-13,16-17,32H,15H2,1-2H3;/q-1;+3/b25-16+; |
| InChIKey | BHJXSSMLNOXQSK-SRTPWMEPSA-N |
| XLogP | 5.08 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|