C27H29N5O — CID 20741024
2-[4-(1-butyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-3-cyano-5-oxo-1-prop-2-enylpyrrol-2-ylidene]propanedinitrile (PubChem CID 20741024) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[4-(1-butyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-3-cyano-5-oxo-1-prop-2-enylpyrrol-2-ylidene]propanedinitrile.
| Compound Name | 2-[4-(1-butyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-3-cyano-5-oxo-1-prop-2-enylpyrrol-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 20741024 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2-[4-(1-butyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-3-cyano-5-oxo-1-prop-2-enylpyrrol-2-ylidene]propanedinitrile |
| SMILES | C=CCN1C(=O)C(c2ccc3c(c2)C(C)CC(C)(C)N3CCCC)=C(C#N)C1=C(C#N)C#N |
| InChI | InChI=1S/C27H29N5O/c1-6-8-12-32-23-10-9-19(13-21(23)18(3)14-27(32,4)5)24-22(17-30)25(20(15-28)16-29)31(11-7-2)26(24)33/h7,9-10,13,18H,2,6,8,11-12,14H2,1,3-5H3 |
| InChIKey | SRVIVASYBXFFTD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|